C18H28N2O3S — CID 135115277
[(4aS,8aS)-1-(2-ethoxyethyl)-4a-(hydroxymethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-thiophen-3-ylmethanone (PubChem CID 135115277) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is [(4aS,8aS)-1-(2-ethoxyethyl)-4a-(hydroxymethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-thiophen-3-ylmethanone.
| Compound Name | [(4aS,8aS)-1-(2-ethoxyethyl)-4a-(hydroxymethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 135115277 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(4aS,8aS)-1-(2-ethoxyethyl)-4a-(hydroxymethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-thiophen-3-ylmethanone |
| SMILES | CCOCCN1CCC[C@]2(CO)CCN(C(=O)c3ccsc3)C[C@@H]12 |
| InChI | InChI=1S/C18H28N2O3S/c1-2-23-10-9-19-7-3-5-18(14-21)6-8-20(12-16(18)19)17(22)15-4-11-24-13-15/h4,11,13,16,21H,2-3,5-10,12,14H2,1H3/t16-,18-/m1/s1 |
| InChIKey | AEPAMVRSESUCII-SJLPKXTDSA-N |
| XLogP | 2.07 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|