C23H24N6O — CID 135121259
4-[4-(1H-indol-6-yl)-8-pyrazolidin-3-yl-1,7-naphthyridin-2-yl]morpholine (PubChem CID 135121259) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 4-[4-(1H-indol-6-yl)-8-pyrazolidin-3-yl-1,7-naphthyridin-2-yl]morpholine.
| Compound Name | 4-[4-(1H-indol-6-yl)-8-pyrazolidin-3-yl-1,7-naphthyridin-2-yl]morpholine |
|---|---|
| PubChem CID | 135121259 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-[4-(1H-indol-6-yl)-8-pyrazolidin-3-yl-1,7-naphthyridin-2-yl]morpholine |
| SMILES | c1cc2c(-c3ccc4cc[nH]c4c3)cc(N3CCOCC3)nc2c(C2CCNN2)n1 |
| InChI | InChI=1S/C23H24N6O/c1-2-16(13-20-15(1)3-6-24-20)18-14-21(29-9-11-30-12-10-29)27-22-17(18)4-7-25-23(22)19-5-8-26-28-19/h1-4,6-7,13-14,19,24,26,28H,5,8-12H2 |
| InChIKey | WMTOXTRDKQHNSX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |