C17H21FN4O8 — CID 135121380
(2S)-2-[[(1S)-1-carboxy-5-[(6-fluoro-3-pyridinyl)amino]-5-oxopentyl]carbamoylamino]pentanedioic acid (PubChem CID 135121380) has the molecular formula C17H21FN4O8 and a molecular weight of 428.37 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[(6-fluoro-3-pyridinyl)amino]-5-oxopentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[(6-fluoro-3-pyridinyl)amino]-5-oxopentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 135121380 |
| Molecular Formula | C17H21FN4O8 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[(6-fluoro-3-pyridinyl)amino]-5-oxopentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCC(=O)Nc1ccc(F)nc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H21FN4O8/c18-12-6-4-9(8-19-12)20-13(23)3-1-2-10(15(26)27)21-17(30)22-11(16(28)29)5-7-14(24)25/h4,6,8,10-11H,1-3,5,7H2,(H,20,23)(H,24,25)(H,26,27)(H,28,29)(H2,21,22,30)/t10-,11-/m0/s1 |
| InChIKey | OAJLMFWIFAWMDP-QWRGUYRKSA-N |
| XLogP | 0.40 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|