C13H7Cl2N3O — CID 135121463
2-amino-4-(2,4-dichlorophenyl)-4H-pyran-3,5-dicarbonitrile (PubChem CID 135121463) has the molecular formula C13H7Cl2N3O and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-amino-4-(2,4-dichlorophenyl)-4H-pyran-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2,4-dichlorophenyl)-4H-pyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 135121463 |
| Molecular Formula | C13H7Cl2N3O |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-amino-4-(2,4-dichlorophenyl)-4H-pyran-3,5-dicarbonitrile |
| SMILES | N#CC1=COC(N)=C(C#N)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl2N3O/c14-8-1-2-9(11(15)3-8)12-7(4-16)6-19-13(18)10(12)5-17/h1-3,6,12H,18H2 |
| InChIKey | PLBIPRGDIUJAOQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |