C14H11N3O — CID 135121444
2-amino-4-(3-methylphenyl)-4H-pyran-3,5-dicarbonitrile (PubChem CID 135121444) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-4-(3-methylphenyl)-4H-pyran-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3-methylphenyl)-4H-pyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 135121444 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-amino-4-(3-methylphenyl)-4H-pyran-3,5-dicarbonitrile |
| SMILES | Cc1cccc(C2C(C#N)=COC(N)=C2C#N)c1 |
| InChI | InChI=1S/C14H11N3O/c1-9-3-2-4-10(5-9)13-11(6-15)8-18-14(17)12(13)7-16/h2-5,8,13H,17H2,1H3 |
| InChIKey | CSOHDYCOCDPJJL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |