C11H16O4S2 — CID 135122004
3-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one (PubChem CID 135122004) has the molecular formula C11H16O4S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one.
| Compound Name | 3-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one |
|---|---|
| PubChem CID | 135122004 |
| Molecular Formula | C11H16O4S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 3-(propyldisulfanyl)-2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one |
| SMILES | CCCSSC1CC2OC(=O)C3CCOC23O1 |
| InChI | InChI=1S/C11H16O4S2/c1-2-5-16-17-9-6-8-11(15-9)7(3-4-13-11)10(12)14-8/h7-9H,2-6H2,1H3 |
| InChIKey | STVMXAJNDWEUOJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|