C8H10O4 — CID 135121984
2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one (PubChem CID 135121984) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one.
| Compound Name | 2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one |
|---|---|
| PubChem CID | 135121984 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2,6,11-trioxatricyclo[6.3.0.01,5]undecan-7-one |
| SMILES | O=C1OC2CCOC23OCCC13 |
| InChI | InChI=1S/C8H10O4/c9-7-5-1-3-10-8(5)6(12-7)2-4-11-8/h5-6H,1-4H2 |
| InChIKey | SOCUHAAADPKVKF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |