C18H17FN4O2 — CID 135124098
5-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-2-[(3R)-oxolan-3-yl]oxypyridine (PubChem CID 135124098) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 5-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-2-[(3R)-oxolan-3-yl]oxypyridine.
| Compound Name | 5-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-2-[(3R)-oxolan-3-yl]oxypyridine |
|---|---|
| PubChem CID | 135124098 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-2-[(3R)-oxolan-3-yl]oxypyridine |
| SMILES | [N-]=[N+]=N[C@@H]1CCc2c(-c3ccc(O[C@@H]4CCOC4)nc3)ccc(F)c21 |
| InChI | InChI=1S/C18H17FN4O2/c19-15-4-2-13(14-3-5-16(18(14)15)22-23-20)11-1-6-17(21-9-11)25-12-7-8-24-10-12/h1-2,4,6,9,12,16H,3,5,7-8,10H2/t12-,16-/m1/s1 |
| InChIKey | YCYANKAKYULINL-MLGOLLRUSA-N |
| XLogP | 4.35 |
| TPSA | 80.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|