C31H31FN2O5 — CID 135124682
ethyl 3-[6-[[(1R)-7-fluoro-4-[6-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-3-pyridinyl]hex-4-ynoate (PubChem CID 135124682) has the molecular formula C31H31FN2O5 and a molecular weight of 530.60 g/mol. Its IUPAC name is ethyl 3-[6-[[(1R)-7-fluoro-4-[6-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-3-pyridinyl]hex-4-ynoate.
| Compound Name | ethyl 3-[6-[[(1R)-7-fluoro-4-[6-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-3-pyridinyl]hex-4-ynoate |
|---|---|
| PubChem CID | 135124682 |
| Molecular Formula | C31H31FN2O5 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | ethyl 3-[6-[[(1R)-7-fluoro-4-[6-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]-3-pyridinyl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OCC)c1ccc(O[C@@H]2CCc3c(-c4ccc(OC5CCOC5)nc4)ccc(F)c32)nc1 |
| InChI | InChI=1S/C31H31FN2O5/c1-3-5-20(16-30(35)37-4-2)21-6-12-29(33-17-21)39-27-11-9-25-24(8-10-26(32)31(25)27)22-7-13-28(34-18-22)38-23-14-15-36-19-23/h6-8,10,12-13,17-18,20,23,27H,4,9,11,14-16,19H2,1-2H3/t20?,23?,27-/m1/s1 |
| InChIKey | KCFMBEJZQRQTAY-LTFVAXTNSA-N |
| XLogP | 5.58 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|