C32H30N2O5 — CID 135125009
3-[4-[[(1R)-5-cyano-4-[6-(oxan-4-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid (PubChem CID 135125009) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is 3-[4-[[(1R)-5-cyano-4-[6-(oxan-4-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[(1R)-5-cyano-4-[6-(oxan-4-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 135125009 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 3-[4-[[(1R)-5-cyano-4-[6-(oxan-4-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(O[C@@H]2CCc3c2ccc(C#N)c3-c2ccc(OC3CCOCC3)nc2)cc1 |
| InChI | InChI=1S/C32H30N2O5/c1-2-3-22(18-31(35)36)21-4-8-25(9-5-21)38-29-12-11-28-27(29)10-6-23(19-33)32(28)24-7-13-30(34-20-24)39-26-14-16-37-17-15-26/h4-10,13,20,22,26,29H,11-12,14-18H2,1H3,(H,35,36)/t22?,29-/m1/s1 |
| InChIKey | DTRZLYJQIUJPQA-OLVCOQPYSA-N |
| XLogP | 5.83 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|