C21H19BrO3 — CID 71206561
3-[4-[[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid (PubChem CID 71206561) has the molecular formula C21H19BrO3 and a molecular weight of 399.28 g/mol. Its IUPAC name is 3-[4-[[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 71206561 |
| Molecular Formula | C21H19BrO3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 3-[4-[[(1R)-5-bromo-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(O[C@@H]2CCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C21H19BrO3/c1-2-3-15(13-21(23)24)14-4-8-18(9-5-14)25-20-11-6-16-12-17(22)7-10-19(16)20/h4-5,7-10,12,15,20H,6,11,13H2,1H3,(H,23,24)/t15?,20-/m1/s1 |
| InChIKey | LTBYJFDDWQNAIN-YQYDADCPSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|