C22H24O4 — CID 70954150
(3S)-3-[4-[(6-methoxy-2,3,5,6-tetrahydro-1H-inden-1-yl)oxy]phenyl]hex-4-ynoic acid (PubChem CID 70954150) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3S)-3-[4-[(6-methoxy-2,3,5,6-tetrahydro-1H-inden-1-yl)oxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[(6-methoxy-2,3,5,6-tetrahydro-1H-inden-1-yl)oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 70954150 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (3S)-3-[4-[(6-methoxy-2,3,5,6-tetrahydro-1H-inden-1-yl)oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OC2CCC3=CCC(OC)C=C32)cc1 |
| InChI | InChI=1S/C22H24O4/c1-3-4-17(13-22(23)24)15-5-9-18(10-6-15)26-21-12-8-16-7-11-19(25-2)14-20(16)21/h5-7,9-10,14,17,19,21H,8,11-13H2,1-2H3,(H,23,24)/t17-,19?,21?/m0/s1 |
| InChIKey | LVSAYZCNINSLGZ-OCDPCBSRSA-N |
| XLogP | 4.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|