C29H28O4 — CID 73301379
3-[4-[[4-(3-ethoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid (PubChem CID 73301379) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[4-[[4-(3-ethoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[4-(3-ethoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 73301379 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 3-[4-[[4-(3-ethoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OC2CCc3c(-c4cccc(OCC)c4)cccc32)cc1 |
| InChI | InChI=1S/C29H28O4/c1-3-7-21(19-29(30)31)20-12-14-23(15-13-20)33-28-17-16-26-25(10-6-11-27(26)28)22-8-5-9-24(18-22)32-4-2/h5-6,8-15,18,21,28H,4,16-17,19H2,1-2H3,(H,30,31) |
| InChIKey | ZDSJSYWTYMYXNM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|