C32H34O4 — CID 71206586
3-[4-[[5-(2-butoxy-5-methylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid (PubChem CID 71206586) has the molecular formula C32H34O4 and a molecular weight of 482.62 g/mol. Its IUPAC name is 3-[4-[[5-(2-butoxy-5-methylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[5-(2-butoxy-5-methylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 71206586 |
| Molecular Formula | C32H34O4 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 3-[4-[[5-(2-butoxy-5-methylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OC2CCc3cc(-c4cc(C)ccc4OCCCC)ccc32)cc1 |
| InChI | InChI=1S/C32H34O4/c1-4-6-18-35-30-16-8-22(3)19-29(30)26-11-15-28-25(20-26)12-17-31(28)36-27-13-9-23(10-14-27)24(7-5-2)21-32(33)34/h8-11,13-16,19-20,24,31H,4,6,12,17-18,21H2,1-3H3,(H,33,34) |
| InChIKey | ZJGJRZOPIPVVNP-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|