C29H32N4O4 — CID 15604429
(3S)-3-[4-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]phenyl]-3-(1-methyltetrazol-5-yl)propanoic acid (PubChem CID 15604429) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is (3S)-3-[4-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]phenyl]-3-(1-methyltetrazol-5-yl)propanoic acid.
| Compound Name | (3S)-3-[4-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]phenyl]-3-(1-methyltetrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 15604429 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | (3S)-3-[4-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]phenyl]-3-(1-methyltetrazol-5-yl)propanoic acid |
| SMILES | CCCCOc1ccc(C)cc1-c1ccc(COc2ccc([C@H](CC(=O)O)c3nnnn3C)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O4/c1-4-5-16-36-27-15-6-20(2)17-25(27)22-9-7-21(8-10-22)19-37-24-13-11-23(12-14-24)26(18-28(34)35)29-30-31-32-33(29)3/h6-15,17,26H,4-5,16,18-19H2,1-3H3,(H,34,35)/t26-/m0/s1 |
| InChIKey | FULWZTPEXIHQCJ-SANMLTNESA-N |
| XLogP | 5.55 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|