C30H31NO5 — CID 69167721
3-[4-[(2-butoxy-5-methylphenyl)-phenylmethoxy]phenyl]-3-(1,3-oxazol-2-yl)propanoic acid (PubChem CID 69167721) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[4-[(2-butoxy-5-methylphenyl)-phenylmethoxy]phenyl]-3-(1,3-oxazol-2-yl)propanoic acid.
| Compound Name | 3-[4-[(2-butoxy-5-methylphenyl)-phenylmethoxy]phenyl]-3-(1,3-oxazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 69167721 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 3-[4-[(2-butoxy-5-methylphenyl)-phenylmethoxy]phenyl]-3-(1,3-oxazol-2-yl)propanoic acid |
| SMILES | CCCCOc1ccc(C)cc1C(Oc1ccc(C(CC(=O)O)c2ncco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO5/c1-3-4-17-34-27-15-10-21(2)19-26(27)29(23-8-6-5-7-9-23)36-24-13-11-22(12-14-24)25(20-28(32)33)30-31-16-18-35-30/h5-16,18-19,25,29H,3-4,17,20H2,1-2H3,(H,32,33) |
| InChIKey | KRFSRKPDGGXDPQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|