C27H23FO4 — CID 143426916
3-[4-[[5-(2-fluoro-5-methoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pent-4-ynoic acid (PubChem CID 143426916) has the molecular formula C27H23FO4 and a molecular weight of 430.48 g/mol. Its IUPAC name is 3-[4-[[5-(2-fluoro-5-methoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pent-4-ynoic acid.
| Compound Name | 3-[4-[[5-(2-fluoro-5-methoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 143426916 |
| Molecular Formula | C27H23FO4 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-[4-[[5-(2-fluoro-5-methoxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pent-4-ynoic acid |
| SMILES | C#CC(CC(=O)O)c1ccc(OC2CCc3cc(-c4cc(OC)ccc4F)ccc32)cc1 |
| InChI | InChI=1S/C27H23FO4/c1-3-17(15-27(29)30)18-4-8-21(9-5-18)32-26-13-7-19-14-20(6-11-23(19)26)24-16-22(31-2)10-12-25(24)28/h1,4-6,8-12,14,16-17,26H,7,13,15H2,2H3,(H,29,30) |
| InChIKey | DGULGOWZUJOYAI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|