C29H26FNO5 — CID 135124557
3-[4-[[(1R)-7-fluoro-4-[6-(oxetan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid (PubChem CID 135124557) has the molecular formula C29H26FNO5 and a molecular weight of 487.53 g/mol. Its IUPAC name is 3-[4-[[(1R)-7-fluoro-4-[6-(oxetan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[(1R)-7-fluoro-4-[6-(oxetan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 135124557 |
| Molecular Formula | C29H26FNO5 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 3-[4-[[(1R)-7-fluoro-4-[6-(oxetan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(O[C@@H]2CCc3c(-c4ccc(OC5COC5)nc4)ccc(F)c32)cc1 |
| InChI | InChI=1S/C29H26FNO5/c1-2-3-19(14-28(32)33)18-4-7-21(8-5-18)35-26-12-10-24-23(9-11-25(30)29(24)26)20-6-13-27(31-15-20)36-22-16-34-17-22/h4-9,11,13,15,19,22,26H,10,12,14,16-17H2,1H3,(H,32,33)/t19?,26-/m1/s1 |
| InChIKey | IBPODFHFMXYVJA-COTLDPOVSA-N |
| XLogP | 5.31 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|