C30H28FNO5 — CID 135124652
3-[4-[[(1R)-7-fluoro-4-[5-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid (PubChem CID 135124652) has the molecular formula C30H28FNO5 and a molecular weight of 501.55 g/mol. Its IUPAC name is 3-[4-[[(1R)-7-fluoro-4-[5-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[(1R)-7-fluoro-4-[5-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 135124652 |
| Molecular Formula | C30H28FNO5 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-[4-[[(1R)-7-fluoro-4-[5-(oxolan-3-yloxy)-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(O[C@@H]2CCc3c(-c4cncc(OC5CCOC5)c4)ccc(F)c32)cc1 |
| InChI | InChI=1S/C30H28FNO5/c1-2-3-20(15-29(33)34)19-4-6-22(7-5-19)37-28-11-9-26-25(8-10-27(31)30(26)28)21-14-24(17-32-16-21)36-23-12-13-35-18-23/h4-8,10,14,16-17,20,23,28H,9,11-13,15,18H2,1H3,(H,33,34)/t20?,23?,28-/m1/s1 |
| InChIKey | QUCSOLASMUHGLL-NRSFRHGKSA-N |
| XLogP | 5.70 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|