C21H24N2O2 — CID 135124904
3-(6-pyridin-4-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl)propanal (PubChem CID 135124904) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-(6-pyridin-4-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl)propanal.
| Compound Name | 3-(6-pyridin-4-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl)propanal |
|---|---|
| PubChem CID | 135124904 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-(6-pyridin-4-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl)propanal |
| SMILES | O=CCCN1CCC2(CCc3cc(-c4ccncc4)ccc3O2)CC1 |
| InChI | InChI=1S/C21H24N2O2/c24-15-1-12-23-13-8-21(9-14-23)7-4-19-16-18(2-3-20(19)25-21)17-5-10-22-11-6-17/h2-3,5-6,10-11,15-16H,1,4,7-9,12-14H2 |
| InChIKey | UVVVVHBUXUAMIW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|