C26H28N2O2 — CID 135125829
3-[6-(8-methylquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]propanal (PubChem CID 135125829) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-[6-(8-methylquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]propanal.
| Compound Name | 3-[6-(8-methylquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]propanal |
|---|---|
| PubChem CID | 135125829 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-[6-(8-methylquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]propanal |
| SMILES | Cc1cc(-c2ccc3c(c2)CCC2(CCN(CCC=O)CC2)O3)cc2cccnc12 |
| InChI | InChI=1S/C26H28N2O2/c1-19-16-23(18-22-4-2-11-27-25(19)22)20-5-6-24-21(17-20)7-8-26(30-24)9-13-28(14-10-26)12-3-15-29/h2,4-6,11,15-18H,3,7-10,12-14H2,1H3 |
| InChIKey | QYKNHDOGAREWHP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|