C22H28N2O2 — CID 143519080
N-methoxy-2-methyl-5-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)aniline (PubChem CID 143519080) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-methoxy-2-methyl-5-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)aniline.
| Compound Name | N-methoxy-2-methyl-5-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)aniline |
|---|---|
| PubChem CID | 143519080 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-methoxy-2-methyl-5-(1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)aniline |
| SMILES | CONc1cc(-c2ccc3c(c2)CCC2(CCN(C)CC2)O3)ccc1C |
| InChI | InChI=1S/C22H28N2O2/c1-16-4-5-18(15-20(16)23-25-3)17-6-7-21-19(14-17)8-9-22(26-21)10-12-24(2)13-11-22/h4-7,14-15,23H,8-13H2,1-3H3 |
| InChIKey | XHDBZCWPLQKUMB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|