C21H16F3N5O2S — CID 135125639
4-methyl-3-[2-[2-(methylcarbamoylamino)-1,3-thiazol-5-yl]ethynyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 135125639) has the molecular formula C21H16F3N5O2S and a molecular weight of 459.45 g/mol. Its IUPAC name is 4-methyl-3-[2-[2-(methylcarbamoylamino)-1,3-thiazol-5-yl]ethynyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-methyl-3-[2-[2-(methylcarbamoylamino)-1,3-thiazol-5-yl]ethynyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 135125639 |
| Molecular Formula | C21H16F3N5O2S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 4-methyl-3-[2-[2-(methylcarbamoylamino)-1,3-thiazol-5-yl]ethynyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CNC(=O)Nc1ncc(C#Cc2cc(C(=O)Nc3cc(C(F)(F)F)ccn3)ccc2C)s1 |
| InChI | InChI=1S/C21H16F3N5O2S/c1-12-3-4-14(18(30)28-17-10-15(7-8-26-17)21(22,23)24)9-13(12)5-6-16-11-27-20(32-16)29-19(31)25-2/h3-4,7-11H,1-2H3,(H,26,28,30)(H2,25,27,29,31) |
| InChIKey | DCRZWLBQXOUJFY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|