C24H18F3N7O — CID 24826897
3-[2-[8-(diaminomethylideneamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]-4-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 24826897) has the molecular formula C24H18F3N7O and a molecular weight of 477.45 g/mol. Its IUPAC name is 3-[2-[8-(diaminomethylideneamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]-4-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 3-[2-[8-(diaminomethylideneamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]-4-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 24826897 |
| Molecular Formula | C24H18F3N7O |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 3-[2-[8-(diaminomethylideneamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]-4-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(F)(F)F)ccn2)cc1C#Cc1cnc2c(N=C(N)N)cccn12 |
| InChI | InChI=1S/C24H18F3N7O/c1-14-4-5-16(22(35)33-20-12-17(8-9-30-20)24(25,26)27)11-15(14)6-7-18-13-31-21-19(32-23(28)29)3-2-10-34(18)21/h2-5,8-13H,1H3,(H4,28,29,32)(H,30,33,35) |
| InChIKey | IHVMXCHFJIBMLQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|