C20H13F3N4O3S — CID 151029746
[5-[2-[2-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]ethynyl]-1,3-thiazol-2-yl] carbamate (PubChem CID 151029746) has the molecular formula C20H13F3N4O3S and a molecular weight of 446.41 g/mol. Its IUPAC name is [5-[2-[2-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]ethynyl]-1,3-thiazol-2-yl] carbamate.
| Compound Name | [5-[2-[2-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]ethynyl]-1,3-thiazol-2-yl] carbamate |
|---|---|
| PubChem CID | 151029746 |
| Molecular Formula | C20H13F3N4O3S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | [5-[2-[2-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]ethynyl]-1,3-thiazol-2-yl] carbamate |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(F)(F)F)ccn2)cc1C#Cc1cnc(OC(N)=O)s1 |
| InChI | InChI=1S/C20H13F3N4O3S/c1-11-2-3-13(17(28)27-16-9-14(6-7-25-16)20(21,22)23)8-12(11)4-5-15-10-26-19(31-15)30-18(24)29/h2-3,6-10H,1H3,(H2,24,29)(H,25,27,28) |
| InChIKey | LZUOIXMNJPFSMD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|