C19H29NO — CID 135128698
3-methyl-2-[(E)-7-methyloct-5-enyl]-2,3,6,7-tetrahydro-1H-quinolin-4-one (PubChem CID 135128698) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-methyl-2-[(E)-7-methyloct-5-enyl]-2,3,6,7-tetrahydro-1H-quinolin-4-one.
| Compound Name | 3-methyl-2-[(E)-7-methyloct-5-enyl]-2,3,6,7-tetrahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 135128698 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 3-methyl-2-[(E)-7-methyloct-5-enyl]-2,3,6,7-tetrahydro-1H-quinolin-4-one |
| SMILES | CC(C)/C=C/CCCCC1NC2=CCCC=C2C(=O)C1C |
| InChI | InChI=1S/C19H29NO/c1-14(2)10-6-4-5-7-12-17-15(3)19(21)16-11-8-9-13-18(16)20-17/h6,10-11,13-15,17,20H,4-5,7-9,12H2,1-3H3/b10-6+ |
| InChIKey | YYZHMKQAOQBYHH-UXBLZVDNSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|