C62H47N7 — CID 135131117
8-[2,6-bis(1,8-dimethylcarbazol-9-yl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-dimethyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 135131117) has the molecular formula C62H47N7 and a molecular weight of 890.11 g/mol. Its IUPAC name is 8-[2,6-bis(1,8-dimethylcarbazol-9-yl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-dimethyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8-[2,6-bis(1,8-dimethylcarbazol-9-yl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-dimethyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 135131117 |
| Molecular Formula | C62H47N7 |
| Molecular Weight | 890.11 g/mol |
| Exact Mass | 889.39 |
| IUPAC Name | 8-[2,6-bis(1,8-dimethylcarbazol-9-yl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-dimethyl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Cc1cccc2c3cccc(C)c3n(-c3cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-n4c5c(C)cccc5c5cccc(C)c54)c3-n3c4c(C)ccnc4c4nccc(C)c43)c12 |
| InChI | InChI=1S/C62H47N7/c1-36-17-13-25-45-46-26-14-18-37(2)56(46)67(55(36)45)51-33-44(50-35-49(42-21-9-7-10-22-42)65-62(66-50)43-23-11-8-12-24-43)34-52(68-57-38(3)19-15-27-47(57)48-28-16-20-39(4)58(48)68)61(51)69-59-40(5)29-31-63-53(59)54-60(69)41(6)30-32-64-54/h7-35H,1-6H3 |
| InChIKey | KOPPYRZJHIPUKH-UHFFFAOYSA-N |
| XLogP | 15.41 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.11 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |