C27H22N6O2 — CID 135132079
(6aR,7R,10aS)-7,10a-dimethyl-4-(5-methyl-1,2,4-oxadiazol-3-yl)-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135132079) has the molecular formula C27H22N6O2 and a molecular weight of 462.51 g/mol. Its IUPAC name is (6aR,7R,10aS)-7,10a-dimethyl-4-(5-methyl-1,2,4-oxadiazol-3-yl)-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-7,10a-dimethyl-4-(5-methyl-1,2,4-oxadiazol-3-yl)-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135132079 |
| Molecular Formula | C27H22N6O2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (6aR,7R,10aS)-7,10a-dimethyl-4-(5-methyl-1,2,4-oxadiazol-3-yl)-8-oxo-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1nc(-c2nc(-c3ccnc4ccccc34)nc3c2CC[C@@H]2[C@@H](C)C(=O)C(C#N)=C[C@@]32C)no1 |
| InChI | InChI=1S/C27H22N6O2/c1-14-20-9-8-19-22(26-30-15(2)35-33-26)31-25(18-10-11-29-21-7-5-4-6-17(18)21)32-24(19)27(20,3)12-16(13-28)23(14)34/h4-7,10-12,14,20H,8-9H2,1-3H3/t14-,20-,27-/m1/s1 |
| InChIKey | JXTBFKYJSUCCIB-FJXHSAOVSA-N |
| XLogP | 4.54 |
| TPSA | 118.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |