C16H28N2O4 — CID 135136074
methyl (E)-5-imino-6-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-enoate (PubChem CID 135136074) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (E)-5-imino-6-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-enoate.
| Compound Name | methyl (E)-5-imino-6-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-enoate |
|---|---|
| PubChem CID | 135136074 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | methyl (E)-5-imino-6-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-enoate |
| SMILES | [H]/N=C(CCCC(=O)OC)/C(=C\CCC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O4/c1-6-7-10-13(18-15(20)22-16(2,3)4)12(17)9-8-11-14(19)21-5/h10,17H,6-9,11H2,1-5H3,(H,18,20)/b13-10+,17-12+ |
| InChIKey | VHEVOXLTRJDRCM-MIBYRVNNSA-N |
| XLogP | 3.56 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|