C7H13N3O4 — CID 173143788
[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid (PubChem CID 173143788) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is [N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid.
| Compound Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 173143788 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H13N3O4/c1-7(2,3)14-6(13)10-4(8)9-5(11)12/h1-3H3,(H,11,12)(H3,8,9,10,13) |
| InChIKey | PNHDOPCCOXWCBY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|