C24H25N4O3P — CID 141234535
tert-butyl N-[N-(6-diphenylphosphanylpyridine-2-carbonyl)carbamimidoyl]carbamate (PubChem CID 141234535) has the molecular formula C24H25N4O3P and a molecular weight of 448.46 g/mol. Its IUPAC name is tert-butyl N-[N-(6-diphenylphosphanylpyridine-2-carbonyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-(6-diphenylphosphanylpyridine-2-carbonyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 141234535 |
| Molecular Formula | C24H25N4O3P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | tert-butyl N-[N-(6-diphenylphosphanylpyridine-2-carbonyl)carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)NC(=O)c1cccc(P(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C24H25N4O3P/c1-24(2,3)31-23(30)28-22(25)27-21(29)19-15-10-16-20(26-19)32(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-16H,1-3H3,(H3,25,27,28,29,30) |
| InChIKey | YRHSBLOBLGUCPU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|