C27H26N4O4 — CID 162468618
tert-butyl N-[N-(3-isocyano-2-phenyl-6-phenylmethoxybenzoyl)carbamimidoyl]carbamate (PubChem CID 162468618) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is tert-butyl N-[N-(3-isocyano-2-phenyl-6-phenylmethoxybenzoyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-(3-isocyano-2-phenyl-6-phenylmethoxybenzoyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 162468618 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | tert-butyl N-[N-(3-isocyano-2-phenyl-6-phenylmethoxybenzoyl)carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)NC(=O)c1c(OCc2ccccc2)ccc([N+]#[C-])c1-c1ccccc1 |
| InChI | InChI=1S/C27H26N4O4/c1-27(2,3)35-26(33)31-25(28)30-24(32)23-21(34-17-18-11-7-5-8-12-18)16-15-20(29-4)22(23)19-13-9-6-10-14-19/h5-16H,17H2,1-3H3,(H3,28,30,31,32,33) |
| InChIKey | KYLKIAAITDRQEK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|