C8H12IN3O2 — CID 135137381
N-(2-aminopropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide (PubChem CID 135137381) has the molecular formula C8H12IN3O2 and a molecular weight of 309.11 g/mol. Its IUPAC name is N-(2-aminopropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-aminopropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135137381 |
| Molecular Formula | C8H12IN3O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-(2-aminopropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(N)CNC(=O)c1cc(CI)on1 |
| InChI | InChI=1S/C8H12IN3O2/c1-5(10)4-11-8(13)7-2-6(3-9)14-12-7/h2,5H,3-4,10H2,1H3,(H,11,13) |
| InChIKey | GDFVQFMMTQKECC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|