C9H14IN3O3 — CID 135137308
N-(2-amino-2-methoxypropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide (PubChem CID 135137308) has the molecular formula C9H14IN3O3 and a molecular weight of 339.13 g/mol. Its IUPAC name is N-(2-amino-2-methoxypropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-amino-2-methoxypropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135137308 |
| Molecular Formula | C9H14IN3O3 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(2-amino-2-methoxypropyl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COC(C)(N)CNC(=O)c1cc(CI)on1 |
| InChI | InChI=1S/C9H14IN3O3/c1-9(11,15-2)5-12-8(14)7-3-6(4-10)16-13-7/h3H,4-5,11H2,1-2H3,(H,12,14) |
| InChIKey | DDFZIQYTEGPWDN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|