C13H24S — CID 135139834
4-cyclohexyl-2-propan-2-ylthiolane (PubChem CID 135139834) has the molecular formula C13H24S and a molecular weight of 212.40 g/mol. Its IUPAC name is 4-cyclohexyl-2-propan-2-ylthiolane.
| Compound Name | 4-cyclohexyl-2-propan-2-ylthiolane |
|---|---|
| PubChem CID | 135139834 |
| Molecular Formula | C13H24S |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 4-cyclohexyl-2-propan-2-ylthiolane |
| SMILES | CC(C)C1CC(C2CCCCC2)CS1 |
| InChI | InChI=1S/C13H24S/c1-10(2)13-8-12(9-14-13)11-6-4-3-5-7-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | WOXOLCSCBGETHL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |