C13H18ClFO — CID 135141219
2-chloro-1-fluoro-4-(2-methylpentan-2-yloxymethyl)benzene (PubChem CID 135141219) has the molecular formula C13H18ClFO and a molecular weight of 244.74 g/mol. Its IUPAC name is 2-chloro-1-fluoro-4-(2-methylpentan-2-yloxymethyl)benzene.
| Compound Name | 2-chloro-1-fluoro-4-(2-methylpentan-2-yloxymethyl)benzene |
|---|---|
| PubChem CID | 135141219 |
| Molecular Formula | C13H18ClFO |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-chloro-1-fluoro-4-(2-methylpentan-2-yloxymethyl)benzene |
| SMILES | CCCC(C)(C)OCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClFO/c1-4-7-13(2,3)16-9-10-5-6-12(15)11(14)8-10/h5-6,8H,4,7,9H2,1-3H3 |
| InChIKey | FWIHEDOSGYLQEX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |