C19H21N5O5S — CID 135150615
methyl 3-[[(1R,2R,6S,7S)-4-(2H-triazole-4-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]sulfonyl]benzoate (PubChem CID 135150615) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is methyl 3-[[(1R,2R,6S,7S)-4-(2H-triazole-4-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]sulfonyl]benzoate.
| Compound Name | methyl 3-[[(1R,2R,6S,7S)-4-(2H-triazole-4-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 135150615 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | methyl 3-[[(1R,2R,6S,7S)-4-(2H-triazole-4-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]sulfonyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N2[C@@H]3CC[C@H]2[C@@H]2CN(C(=O)c4cn[nH]n4)C[C@@H]23)c1 |
| InChI | InChI=1S/C19H21N5O5S/c1-29-19(26)11-3-2-4-12(7-11)30(27,28)24-16-5-6-17(24)14-10-23(9-13(14)16)18(25)15-8-20-22-21-15/h2-4,7-8,13-14,16-17H,5-6,9-10H2,1H3,(H,20,21,22)/t13-,14+,16+,17- |
| InChIKey | GARJOOHREKPGRA-ULAZLLGUSA-N |
| XLogP | 0.51 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |