C19H19N5 — CID 135152842
5,5,6,6-tetramethyl-8-quinoxalin-2-ylpyrido[3,4-d]pyrimidine (PubChem CID 135152842) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 5,5,6,6-tetramethyl-8-quinoxalin-2-ylpyrido[3,4-d]pyrimidine.
| Compound Name | 5,5,6,6-tetramethyl-8-quinoxalin-2-ylpyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 135152842 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 5,5,6,6-tetramethyl-8-quinoxalin-2-ylpyrido[3,4-d]pyrimidine |
| SMILES | CC1(C)N=C(c2cnc3ccccc3n2)c2ncncc2C1(C)C |
| InChI | InChI=1S/C19H19N5/c1-18(2)12-9-20-11-22-16(12)17(24-19(18,3)4)15-10-21-13-7-5-6-8-14(13)23-15/h5-11H,1-4H3 |
| InChIKey | XRBMZLSVJGMBDN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |