C11H6F5N3OS — CID 135153632
4-(difluoromethyl)-N-[3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide (PubChem CID 135153632) has the molecular formula C11H6F5N3OS and a molecular weight of 323.25 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-(difluoromethyl)-N-[3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 135153632 |
| Molecular Formula | C11H6F5N3OS |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-(difluoromethyl)-N-[3-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1snnc1C(F)F |
| InChI | InChI=1S/C11H6F5N3OS/c12-9(13)7-8(21-19-18-7)10(20)17-6-3-1-2-5(4-6)11(14,15)16/h1-4,9H,(H,17,20) |
| InChIKey | URGFAQXZOWJYAV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |