C5H7N3O3 — CID 135154151
4-oxoazetidine-1,2-dicarboxamide (PubChem CID 135154151) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is 4-oxoazetidine-1,2-dicarboxamide.
| Compound Name | 4-oxoazetidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 135154151 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 4-oxoazetidine-1,2-dicarboxamide |
| SMILES | NC(=O)C1CC(=O)N1C(N)=O |
| InChI | InChI=1S/C5H7N3O3/c6-4(10)2-1-3(9)8(2)5(7)11/h2H,1H2,(H2,6,10)(H2,7,11) |
| InChIKey | MQAXKONRRSCXAL-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |