C21H28ClN3O2 — CID 135155259
6-chloro-10-methoxy-9-(3-pyrrolidin-1-ylpropoxy)-2,3,4,5-tetrahydro-1H-azepino[3,2-c]quinoline (PubChem CID 135155259) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 6-chloro-10-methoxy-9-(3-pyrrolidin-1-ylpropoxy)-2,3,4,5-tetrahydro-1H-azepino[3,2-c]quinoline.
| Compound Name | 6-chloro-10-methoxy-9-(3-pyrrolidin-1-ylpropoxy)-2,3,4,5-tetrahydro-1H-azepino[3,2-c]quinoline |
|---|---|
| PubChem CID | 135155259 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 6-chloro-10-methoxy-9-(3-pyrrolidin-1-ylpropoxy)-2,3,4,5-tetrahydro-1H-azepino[3,2-c]quinoline |
| SMILES | COc1cc2c3c(c(Cl)nc2cc1OCCCN1CCCC1)CCCCN3 |
| InChI | InChI=1S/C21H28ClN3O2/c1-26-18-13-16-17(24-21(22)15-7-2-3-8-23-20(15)16)14-19(18)27-12-6-11-25-9-4-5-10-25/h13-14,23H,2-12H2,1H3 |
| InChIKey | COQDSPYNXSZJGZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|