C21H28ClN3O2 — CID 135155512
5-chloro-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-2,4-dihydro-1H-benzo[c][2,7]naphthyridine (PubChem CID 135155512) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 5-chloro-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-2,4-dihydro-1H-benzo[c][2,7]naphthyridine.
| Compound Name | 5-chloro-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-2,4-dihydro-1H-benzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 135155512 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 5-chloro-9-methoxy-3-methyl-8-(3-pyrrolidin-1-ylpropoxy)-2,4-dihydro-1H-benzo[c][2,7]naphthyridine |
| SMILES | COc1cc2c3c(c(Cl)nc2cc1OCCCN1CCCC1)CN(C)CC3 |
| InChI | InChI=1S/C21H28ClN3O2/c1-24-10-6-15-16-12-19(26-2)20(13-18(16)23-21(22)17(15)14-24)27-11-5-9-25-7-3-4-8-25/h12-13H,3-11,14H2,1-2H3 |
| InChIKey | GLADBGVAFNLMGF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|