C19H21ClN2O4 — CID 140883775
4-chloro-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-3H-furo[3,4-c]quinolin-1-one (PubChem CID 140883775) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 4-chloro-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-3H-furo[3,4-c]quinolin-1-one.
| Compound Name | 4-chloro-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-3H-furo[3,4-c]quinolin-1-one |
|---|---|
| PubChem CID | 140883775 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-chloro-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-3H-furo[3,4-c]quinolin-1-one |
| SMILES | COc1cc2c3c(c(Cl)nc2cc1OCCCN1CCCC1)COC3=O |
| InChI | InChI=1S/C19H21ClN2O4/c1-24-15-9-12-14(21-18(20)13-11-26-19(23)17(12)13)10-16(15)25-8-4-7-22-5-2-3-6-22/h9-10H,2-8,11H2,1H3 |
| InChIKey | UJUFKRPWQBVAPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|