C21H33N3O4S — CID 135157939
methyl 3-[4-[[[2-methylpropyl(oxan-4-yl)amino]-sulfanylcarbamoyl]amino]phenyl]butanoate (PubChem CID 135157939) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is methyl 3-[4-[[[2-methylpropyl(oxan-4-yl)amino]-sulfanylcarbamoyl]amino]phenyl]butanoate.
| Compound Name | methyl 3-[4-[[[2-methylpropyl(oxan-4-yl)amino]-sulfanylcarbamoyl]amino]phenyl]butanoate |
|---|---|
| PubChem CID | 135157939 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | methyl 3-[4-[[[2-methylpropyl(oxan-4-yl)amino]-sulfanylcarbamoyl]amino]phenyl]butanoate |
| SMILES | COC(=O)CC(C)c1ccc(NC(=O)N(S)N(CC(C)C)C2CCOCC2)cc1 |
| InChI | InChI=1S/C21H33N3O4S/c1-15(2)14-23(19-9-11-28-12-10-19)24(29)21(26)22-18-7-5-17(6-8-18)16(3)13-20(25)27-4/h5-8,15-16,19,29H,9-14H2,1-4H3,(H,22,26) |
| InChIKey | JBGISRNWGUNTIS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|