C49H41NO2 — CID 135159418
9-cyclohexa-1,5-dien-1-yl-3-[(2'S)-5'-phenyl-9,9'-spirobi[1,2-dihydroxanthene]-2'-yl]-3,4,4a,9a-tetrahydrocarbazole (PubChem CID 135159418) has the molecular formula C49H41NO2 and a molecular weight of 675.87 g/mol. Its IUPAC name is 9-cyclohexa-1,5-dien-1-yl-3-[(2'S)-5'-phenyl-9,9'-spirobi[1,2-dihydroxanthene]-2'-yl]-3,4,4a,9a-tetrahydrocarbazole.
| Compound Name | 9-cyclohexa-1,5-dien-1-yl-3-[(2'S)-5'-phenyl-9,9'-spirobi[1,2-dihydroxanthene]-2'-yl]-3,4,4a,9a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 135159418 |
| Molecular Formula | C49H41NO2 |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | 9-cyclohexa-1,5-dien-1-yl-3-[(2'S)-5'-phenyl-9,9'-spirobi[1,2-dihydroxanthene]-2'-yl]-3,4,4a,9a-tetrahydrocarbazole |
| SMILES | C1=CC(N2c3ccccc3C3CC([C@@H]4C=CC5=C(C4)C4(C6=C(C=CCC6)Oc6ccccc64)c4cccc(-c6ccccc6)c4O5)C=CC32)=CCC1 |
| InChI | InChI=1S/C49H41NO2/c1-3-14-32(15-4-1)36-19-13-22-41-48(36)52-47-29-27-34(31-42(47)49(41)39-20-8-11-24-45(39)51-46-25-12-9-21-40(46)49)33-26-28-44-38(30-33)37-18-7-10-23-43(37)50(44)35-16-5-2-6-17-35/h1,3-5,7-8,10-20,22-29,33-34,38,44H,2,6,9,21,30-31H2/t33?,34-,38?,44?,49?/m1/s1 |
| InChIKey | DPONVWXMCMSGKD-AHVLMANISA-N |
| XLogP | 11.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|