C25H24FIN4O3S2 — CID 135159883
tert-butyl 1-(4-fluorophenyl)-4a-(2-iodosulfanyl-1,3-thiazole-4-carbonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-6-carboxylate (PubChem CID 135159883) has the molecular formula C25H24FIN4O3S2 and a molecular weight of 638.53 g/mol. Its IUPAC name is tert-butyl 1-(4-fluorophenyl)-4a-(2-iodosulfanyl-1,3-thiazole-4-carbonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-6-carboxylate.
| Compound Name | tert-butyl 1-(4-fluorophenyl)-4a-(2-iodosulfanyl-1,3-thiazole-4-carbonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 135159883 |
| Molecular Formula | C25H24FIN4O3S2 |
| Molecular Weight | 638.53 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | tert-butyl 1-(4-fluorophenyl)-4a-(2-iodosulfanyl-1,3-thiazole-4-carbonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinoline-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2=Cc3c(cnn3-c3ccc(F)cc3)CC2(C(=O)c2csc(SI)n2)C1 |
| InChI | InChI=1S/C25H24FIN4O3S2/c1-24(2,3)34-23(33)30-9-8-16-10-20-15(12-28-31(20)18-6-4-17(26)5-7-18)11-25(16,14-30)21(32)19-13-35-22(29-19)36-27/h4-7,10,12-13H,8-9,11,14H2,1-3H3 |
| InChIKey | FBZQBQBTQZHWHX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|