C19H35N3O2S — CID 135161836
ethoxy-[2-(4-thiomorpholin-4-ylpiperidin-1-yl)-6-azaspiro[3.4]octan-6-yl]methanol (PubChem CID 135161836) has the molecular formula C19H35N3O2S and a molecular weight of 369.58 g/mol. Its IUPAC name is ethoxy-[2-(4-thiomorpholin-4-ylpiperidin-1-yl)-6-azaspiro[3.4]octan-6-yl]methanol.
| Compound Name | ethoxy-[2-(4-thiomorpholin-4-ylpiperidin-1-yl)-6-azaspiro[3.4]octan-6-yl]methanol |
|---|---|
| PubChem CID | 135161836 |
| Molecular Formula | C19H35N3O2S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | ethoxy-[2-(4-thiomorpholin-4-ylpiperidin-1-yl)-6-azaspiro[3.4]octan-6-yl]methanol |
| SMILES | CCOC(O)N1CCC2(CC(N3CCC(N4CCSCC4)CC3)C2)C1 |
| InChI | InChI=1S/C19H35N3O2S/c1-2-24-18(23)22-8-5-19(15-22)13-17(14-19)20-6-3-16(4-7-20)21-9-11-25-12-10-21/h16-18,23H,2-15H2,1H3 |
| InChIKey | LEOVRSDXQNKVHV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|