C21H36F2N4O4 — CID 135161900
(2R)-1-[1-[6-[ethoxy(hydroxy)methyl]-6-azaspiro[3.4]octan-2-yl]piperidin-4-yl]-4,4-difluoro-N-methoxypyrrolidine-2-carboxamide (PubChem CID 135161900) has the molecular formula C21H36F2N4O4 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2R)-1-[1-[6-[ethoxy(hydroxy)methyl]-6-azaspiro[3.4]octan-2-yl]piperidin-4-yl]-4,4-difluoro-N-methoxypyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[1-[6-[ethoxy(hydroxy)methyl]-6-azaspiro[3.4]octan-2-yl]piperidin-4-yl]-4,4-difluoro-N-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135161900 |
| Molecular Formula | C21H36F2N4O4 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R)-1-[1-[6-[ethoxy(hydroxy)methyl]-6-azaspiro[3.4]octan-2-yl]piperidin-4-yl]-4,4-difluoro-N-methoxypyrrolidine-2-carboxamide |
| SMILES | CCOC(O)N1CCC2(CC(N3CCC(N4CC(F)(F)C[C@@H]4C(=O)NOC)CC3)C2)C1 |
| InChI | InChI=1S/C21H36F2N4O4/c1-3-31-19(29)26-9-6-20(13-26)10-16(11-20)25-7-4-15(5-8-25)27-14-21(22,23)12-17(27)18(28)24-30-2/h15-17,19,29H,3-14H2,1-2H3,(H,24,28)/t16?,17-,19?,20?/m1/s1 |
| InChIKey | NDVAZPABGVASCI-KWTWZXGMSA-N |
| XLogP | 1.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|