About [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone
[5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone (PubChem CID 135162424) has the molecular formula C18H15N7O
and a molecular weight of 345.37 g/mol. Its IUPAC name is [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone.
Molecular Properties
| Compound Name | [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone |
| PubChem CID | 135162424 |
| Molecular Formula | C18H15N7O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone |
| SMILES | Nc1c(C(=O)c2cc3ccccc3[nH]2)cnn1-c1ccc2c(c1)NNN2 |
| InChI | InChI=1S/C18H15N7O/c19-18-12(17(26)16-7-10-3-1-2-4-13(10)21-16)9-20-25(18)11-5-6-14-15(8-11)23-24-22-14/h1-9,21-24H,19H2 |
| InChIKey | FJUYDJJENRIBSA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone?
The IUPAC name of [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone (CID 135162424) is [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone.
What is the SMILES notation for [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone?
The canonical SMILES for [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone is Nc1c(C(=O)c2cc3ccccc3[nH]2)cnn1-c1ccc2c(c1)NNN2.
What is the InChIKey of [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone?
The InChIKey is FJUYDJJENRIBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N7O/c19-18-12(17(26)16-7-10-3-1-2-4-13(10)21-16)9-20-25(18)11-5-6-14-15(8-11)23-24-22-14/h1-9,21-24H,19H2.
What are the key properties of [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone?
[5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone has a molecular weight of 345.37 g/mol, XLogP of 2.42, 3 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-1-(2,3-dihydro-1H-benzotriazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone is sourced from PubChem (CID 135162424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).