C13H25N3O — CID 135170107
dimethylamino-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]methanol (PubChem CID 135170107) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is dimethylamino-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]methanol.
| Compound Name | dimethylamino-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]methanol |
|---|---|
| PubChem CID | 135170107 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | dimethylamino-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]methanol |
| SMILES | CN1CC=C([C@@H]2CCCN2C(O)N(C)C)CC1 |
| InChI | InChI=1S/C13H25N3O/c1-14(2)13(17)16-8-4-5-12(16)11-6-9-15(3)10-7-11/h6,12-13,17H,4-5,7-10H2,1-3H3/t12-,13?/m0/s1 |
| InChIKey | JIRLPIRUEBNEJM-UEWDXFNNSA-N |
| XLogP | 0.55 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|